loreb9949 loreb9949

07-07-2018
Chemistry

contestada

How does decreasing the temperature affect the volume of a gas?

Respuesta :

SvetkaChem SvetkaChem

07-07-2018

Relationship between Temperature (T) and Volume (V) of the gas is directly proportional.
V1/V2 = T1/T2

When T is higher, the volume(V) is bigger.
When T is lower, the volume(V) is less.

Answer Link

Otras preguntas

What would you do if you were an alien on a mission in earth? (funny answer only.)

reply Karo koi jaldi se bore hoo Raha hai

5. What is the function of the mitochondria? A. Synthesizes proteins. B. Transport of wastes out of the cell. C. Important in animal cell during cell division.

3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of alumin

at a small university of 10,000 students it is believed 60% own a laptop. to determine weather or not proportion is accurate, you take a random sampling of 50 s

Katelynn and Genevieve want to make flyers to advertise their school's play. They will collaborate on the flyer document online, and remotely. Which productivi

m is directly proportional to r cubed when r = 4 m= 160 work out the value of r when m= 540

Activity 4: Matching Directions: Match the following vocabulary words to their synonyms from the box. Write your answer in the column next to the word. Syn

Find the 14* term of the following geometric sequence. 4, 8, 16,32, ...

Exponential and Logarithmic Functions