hayleymaier10 hayleymaier10

06-01-2024
Chemistry

contestada

3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O
Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of aluminum hydroxide

Respuesta :

Otras preguntas

A recipie calls for 2 3/4 cups of milk. How many cups of milk,written asa fraction greater than one,are used in the recipie.

what weighs more, a ton of feathers or a ton of bricks

Who was the president of continental congress? a. thomas jefferson b. george washington c. robert livingston d. john hancock user: all of the following men

Please, Only Answer If You Are Sure___Islam respects idol worship? True or False

What is the compression to ventilation rate for Adults, Children, and Infants

what is a symphonic poem? how is it related to programme music?

How long should you hold stretches? 1 minute 45 seconds 15 seconds 5 seconds

what might happen if the population of producers in this ecosystem died off. Explain?

the first plant to grow in new environments are usually a. ferns and horsetails b. grasses c. liverworts d. mosses and ferns

Can someone help me understand about cross sections?