JayJay6804 JayJay6804

08-05-2017
English

contestada

Is Northwestern University a 2 or 4-year college?

I need to know for a project I'm doing

Respuesta :

amandag2 amandag2

08-05-2017

Its a 4 to 5 year college.
hope this helps!

Answer Link

Otras preguntas

Decide if the following conjugated verbs are regular or irregular.I will give brainiest to the first to answer correctly. Thank you.

What is the total amount for an investment of $1000 invested at 7.25% for 15 years and compound continuously?

(Please reply fast) What territory did Rome gain control of during the Punic Wars? A) Rome gained control of the mainland islands

How did the United States respond to changes in the global economy

After feasting with Eumaeus, where does Odysseus sleep?

Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct

Calculate the drops per minute “gtts/min” for the following questions. Be sure to write your answer in gtts /min. 1. 250 ml/hour using macro tubing 20 gtts/ml _

A rock is dropped from a bridge 320 feet above the river. The pathway that the rock takes can be modeled by the equation h= -16t2+320. How long will it take the

The graph of 3x + 4x = -1 is shown on the grid. Which ordered pair is in the solution set of 3x + 4y ≤ -1? A. (2, 6) B. (6,2) C. (2, -6) D. (-2, 6)

José y Pedro van a __________esa canción. canta cantamos cantan cantar