4111asmit02 4111asmit02

10-05-2022
Mathematics

contestada

If my Grade is a 64% and I Get a 100% What will my grade be?

Respuesta :

69sixnine9558 69sixnine9558

10-05-2022

Answer:

probably 66%

Step-by-step explanation:

if you get 50% it will be -23% jk but it seams you get bad grade it goes down a lot but get 100 it goes up a little

Answer Link

Otras preguntas

How do I solve y-2=1/3(x-1) and convert to slope intercept? This is point slope form.

IUPAC NAME FOR:CH2(OH)-CH2-CH(C2H5)-OH

1. What is the missing statement in the proof? Given: 1/2 3 Prove: || m 21 22 Given 21 23 Vertical Zs are. Transitive Property of 1 2 | || m Corres. Zs are. m N

Yesterday there were 75 problems assigned for math homework Jeanette did 48% of them correctly how many problems did Jeanette get right?

In the following reaction, is aluminum being oxidized or reduced? 4Al (s) + 3O2(g) → 2Al2O3(s)

89,74,92,80, the mean score is 79 what the number is missing???

Who was the first government

If the number of chromosomes in the skin cells of an organism is 28. What is the number of chromosomes in the organisms egg cell

What is 6099 divided by 7

IUPAC name for Ch3-Ch(Ch3)-Ch(br)-Ch3