skyelopez7 skyelopez7

10-02-2021
Mathematics

contestada

Twice the square of a number minus 3 is 47. Find the number

Respuesta :

graciebelle0419 graciebelle0419

10-02-2021

Answer:

5

Explanation:

5 squared is 25. 25 times 2 is 50. 50 minus 3 is 47.

Answer Link

Otras preguntas

What connection did Renaissance thinkers want to make between the Goths and the church by using the term Gothic? A) both were backward and barbaric and should b

Juan pulled a red card from the deck of regular playing cards. This probability is 2652 or 12 . He puts the card back into the deck. Will his chance of pulling

Which of the following explains why photosystem units contain a high proportion of antenna pigments compared to reaction centers? A. Antenna pigments split wate

What is the principal square root of -2500?

The expansion of democracy in the Age of Jackson encouraged reform. Most states dropped property requirements for _____. voting holding public office owning sla

though the outcomes of schemck and new york times differed, what did these decisions have in common

Which of the following ordered pairs represents a solution to the linear inequality y>2x-3? A. (4, 4) B. (2, 5) C. (3, 2) D. (9, 12)

50PTS and brainliest! type a paragraph explaining how the atoms in sugar molecules can be used to form amino acids and other large carbon-based molecules.

Step 1 Step 2 Step 3 Step 4 ?????

Which of the following is a simpler form of the expression sin(0)sec(0)/cos(0)tan(0)