kederson7280 kederson7280

08-12-2022
Physics

contestada

an electron travels through space and has a velocity uncertainty of 131 m/s. what is the minimum uncertainty in the electron's position?

Respuesta :

Otras preguntas

why do scientists publish the results of their invesigation

jose went jogging with sam. jose jogged 5/8 miles before resting. sam jogged 1/4 mile more before stopping. after resting, they continued jogging. each of them

For all values of x, which expression is equivalent to 9(2x+9)+2(2x+9)

___________ is the process by which a cell duplicates the DNA. Question 4 options: Transcription Translation Replication Synthesis

What do you know about Brazil?

Your foot is connected to your leg. In Spanish, these two body parts are ______.

What is the definition of work?

Need help with 49 guys please help

2,601,400,070 written out ?

Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct